5-Nitrobenzo[d]thiazol-2-amine structure
|
Common Name | 5-Nitrobenzo[d]thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 73458-39-6 | Molecular Weight | 195.199 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 411.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8±26.5 °C | |
| Name | 5-nitro-1,3-benzothiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.7±37.0 °C at 760 mmHg |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.199 |
| Flash Point | 202.8±26.5 °C |
| Exact Mass | 195.010239 |
| PSA | 112.97000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.798 |
| InChIKey | FISVWAMPAATJLP-UHFFFAOYSA-N |
| SMILES | Nc1nc2cc([N+](=O)[O-])ccc2s1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2934200090 |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitro-1,3-benzothiazol-2-amine |
| 2-amino-5-nitrobenzothiazole |
| 5-nitrobenzothiazol-2-amine |
| MFCD00160073 |
| 2-Benzothiazolamine, 5-nitro- |
| 5-Nitrobenzothiazol-2-ylamine |
| 5-Nitro-2-amino-benzthiazol |
| 5-nitrobenzo[d]thiazol-2-amine |
| 2-Amino-5-nitrobenzothizole |
| 2-amino-5-nitro-1,3-benzothiazole |
| 5-Nitro-benzothiazol-2-ylamine |