Benzenesulfonamide,4-methyl-N-(4-nitrophenyl)-
Modify Date: 2025-08-26 10:30:56
Benzenesulfonamide,4-methyl-N-(4-nitrophenyl)- structure
|
Common Name | Benzenesulfonamide,4-methyl-N-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 734-25-8 | Molecular Weight | 292.31000 | |
| Density | 1.414g/cm3 | Boiling Point | 469.5ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O4S | Melting Point | 191 °C | |
| MSDS | N/A | Flash Point | 237.7ºC | |
| Name | 4'-Nitro-p-toluenesulfonanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 469.5ºC at 760 mmHg |
| Melting Point | 191 °C |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.31000 |
| Flash Point | 237.7ºC |
| Exact Mass | 292.05200 |
| PSA | 100.37000 |
| LogP | 4.38100 |
| Index of Refraction | 1.641 |
| InChIKey | ACOIHAFYVPPSOZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| Risk Phrases | R52/53:Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment . |
|---|---|
| Safety Phrases | S61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 1 |
| RTECS | CY2625000 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| EINECS 211-994-2 |
| 4-methyl-N-(4-nitrophenyl)benzenesulfonamide |
| MFCD00129916 |