1,4-Dihydro-1,2-dimethyl-4-oxo -3-quilinecarboxylic acid structure
|
Common Name | 1,4-Dihydro-1,2-dimethyl-4-oxo -3-quilinecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 73281-83-1 | Molecular Weight | 217.221 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 352.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1±27.9 °C | |
| Name | 1,2-Dimethyl-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.7±42.0 °C at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.221 |
| Flash Point | 167.1±27.9 °C |
| Exact Mass | 217.073898 |
| PSA | 59.30000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | RDEXTEPFIVECBD-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)O)c(=O)c2ccccc2n1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-Dimethyl-4-nitromethyl-5-benzoyl-1-cyclohexen |
| 1,2-Dimethyl-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid |
| 3-Quinolinecarboxylic acid, 1,4-dihydro-1,2-dimethyl-4-oxo- |
| 1,2-dimethyl-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid |