Decanedioic acid hydrogen 1-(2-ethylhexyl) ester structure
|
Common Name | Decanedioic acid hydrogen 1-(2-ethylhexyl) ester | ||
|---|---|---|---|---|
| CAS Number | 7327-98-2 | Molecular Weight | 313.45200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H33O4- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-(2-ethylhexoxy)-10-oxodecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H33O4- |
|---|---|
| Molecular Weight | 313.45200 |
| Exact Mass | 313.23800 |
| PSA | 66.43000 |
| LogP | 3.61670 |
| InChIKey | CICDSZCELMNDRA-UHFFFAOYSA-M |
| SMILES | CCCCC(CC)COC(=O)CCCCCCCCC(=O)[O-] |
|
~%
Decanedioic aci... CAS#:7327-98-2 |
| Literature: James et al. Industrial and Engineering Chemistry, 1959 , vol. 51, p. 673 |
|
~%
Decanedioic aci... CAS#:7327-98-2 |
| Literature: Sommers; Crowell Journal of the American Chemical Society, 1955 , vol. 77, p. 5443 |
| Decandisaeure-mono-(2-aethyl-hexylester) |
| 2-ethylhexyl sebacate |
| decanedioic acid mono-(2-ethyl-hexyl ester) |