2-diethylamino-N-[6-[(2-diethylaminoacetyl)amino]-9,10-dioxo-anthracen-2-yl]acetamide structure
|
Common Name | 2-diethylamino-N-[6-[(2-diethylaminoacetyl)amino]-9,10-dioxo-anthracen-2-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 72966-57-5 | Molecular Weight | 464.55700 | |
| Density | 1.249g/cm3 | Boiling Point | 718.9ºC at 760 mmHg | |
| Molecular Formula | C26H32N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.6ºC | |
| Name | 2-(diethylamino)-N-[6-[[2-(diethylamino)acetyl]amino]-9,10-dioxoanthracen-2-yl]acetamide |
|---|
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 718.9ºC at 760 mmHg |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.55700 |
| Flash Point | 388.6ºC |
| Exact Mass | 464.24200 |
| PSA | 98.82000 |
| LogP | 3.16860 |
| Index of Refraction | 1.626 |
| InChIKey | COLRGEANOXVELY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)Nc1ccc2c(c1)C(=O)c1ccc(NC(=O)CN(CC)CC)cc1C2=O |
|
~60%
2-diethylamino-... CAS#:72966-57-5 |
| Literature: Agbandje, Mavis; Jenkins, Terence C.; McKenna, Robert; Reszka, Anthony P.; Neidle, Stephen Journal of Medicinal Chemistry, 1992 , vol. 35, # 8 p. 1418 - 1429 |
|
~%
2-diethylamino-... CAS#:72966-57-5 |
| Literature: Hoffmann, Siegfried; Skoelziger, Regina; Witkowski, Werner Zeitschrift fuer Chemie (Stuttgart, Germany), 1986 , vol. 26, # 6 p. 206 - 207 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |