Cyclo(-L-Leu-L-Phe) structure
|
Common Name | Cyclo(-L-Leu-L-Phe) | ||
|---|---|---|---|---|
| CAS Number | 7280-77-5 | Molecular Weight | 260.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Cyclo(-L-Leu-L-Phe)Cyclo(-Leu-Phe) is a cyclic peptide composed of leucine and phenylalanine, forming a ring structure through peptide bonds[1]. |
| Name | cyclo(L-phenylalanyl-L-leucyl) |
|---|---|
| Synonym | More Synonyms |
| Description | Cyclo(-Leu-Phe) is a cyclic peptide composed of leucine and phenylalanine, forming a ring structure through peptide bonds[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H20N2O2 |
|---|---|
| Molecular Weight | 260.33 |
| Exact Mass | 260.15200 |
| PSA | 58.20000 |
| LogP | 1.91600 |
| InChIKey | QPDMOMIYLJMOQJ-STQMWFEESA-N |
| SMILES | CC(C)CC1NC(=O)C(Cc2ccccc2)NC1=O |
| Storage condition | -20°C |
| Cyclo(Leu-Phe) |
| Cyclo-(L)-phenylalanyl-(L)-leucyl |
| Cyclo(-Leu-Phe) |