Estropipate
Modify Date: 2025-08-22 18:32:34
Estropipate structure
|
Common Name | Estropipate | ||
|---|---|---|---|---|
| CAS Number | 7280-37-7 | Molecular Weight | 436.565 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32N2O5S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
Use of EstropipateEstropipate is a form of estrogen, used to treat symptoms of menopause, also used to prevent osteoporosis. |
| Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate,piperazine |
|---|---|
| Synonym | More Synonyms |
| Description | Estropipate is a form of estrogen, used to treat symptoms of menopause, also used to prevent osteoporosis. |
|---|---|
| Related Catalog |
| Molecular Formula | C22H32N2O5S |
|---|---|
| Molecular Weight | 436.565 |
| Exact Mass | 436.203186 |
| PSA | 113.11000 |
| LogP | 4.21100 |
| InChIKey | HZEQBCVBILBTEP-ZFINNJDLSA-N |
| SMILES | C1CNCCN1.CC12CCC3c4ccc(OS(=O)(=O)O)cc4CCC3C1CCC2=O |
| Storage condition | Store at RT |
CHEMICAL IDENTIFICATION
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H350 |
| Precautionary Statements | P201-P280-P301 + P312 + P330-P308 + P313 |
| Hazard Codes | T |
| Risk Phrases | 45-22 |
| Safety Phrases | 53-45 |
| RIDADR | NONH for all modes of transport |
| RTECS | KG7785000 |
|
An acidic microenvironment sets the humoral pattern recognition molecule PTX3 in a tissue repair mode.
J. Exp. Med. 212 , 905-25, (2015) Pentraxin 3 (PTX3) is a fluid-phase pattern recognition molecule and a key component of the humoral arm of innate immunity. In four different models of tissue damage in mice, PTX3 deficiency was assoc... |
|
|
Aqueous leaf extract of Jatropha gossypiifolia L. (Euphorbiaceae) inhibits enzymatic and biological actions of Bothrops jararaca snake venom.
PLoS ONE 9(8) , e104952, (2014) Snakebites are a serious public health problem due their high morbi-mortality. The main available specific treatment is the antivenom serum therapy, which has some disadvantages, such as poor neutrali... |
| hydrogène sulfate de (8R,9S,13S,14S)-13-méthyl-17-oxo-7,8,9,11,12,13,14,15,16,17-décahydro-6H-cyclopenta[a]phénanthrén-3-yle - pipérazine (1:1) |
| Estrone hydrogen sulfate compound with piperazine (1:1) |
| Ogen |
| ORTHO-EST |
| Piperazinestron-sulfat |
| Estropipate |
| Estra-1,3,5(10)-trien-17-one 3-sulphate compound with Piperazine (1:1) |
| (8R,9S,13S,14S)-13-Methyl-17-oxo-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-ylhydrogen-sulfat-piperazin(1:1) |
| Estra-1,3,5(10)-trien-17-one, 3-(sulfooxy)-, compd. with piperazine (1:1) |
| UNII-SVI38UY019 |
| 17-Oxoestra-1,3,5(10)-trien-3-yl hydrogen sulfate - piperazine (1:1) |
| Estrone sulfate piperazine |
| (8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-yl hydrogen sulfate - piperazine (1:1) |
| Sulestrex |
| piperazine oestrone sulphate |
| MFCD00867399 |
| Harmogen |
| EINECS 230-696-3 |
| Piperazine estrone sulfate |