Mesulergine hydrochloride structure
|
Common Name | Mesulergine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 72786-12-0 | Molecular Weight | 362.49000 | |
| Density | 1.38g/cm3 | Boiling Point | 545.7ºC at 760mmHg | |
| Molecular Formula | C18H26N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.8ºC | |
| Name | (6aR,9S,10aR)-9-(dimethylsulfamoylamino)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 545.7ºC at 760mmHg |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.49000 |
| Flash Point | 283.8ºC |
| Exact Mass | 362.17800 |
| PSA | 65.96000 |
| LogP | 2.69630 |
| InChIKey | HANSYUJEPWNHIM-IVMONYBCSA-N |
| SMILES | CN1CC(NS(=O)(=O)N(C)C)CC2c3cccc4c3c(cn4C)CC21.Cl |
|
~%
Mesulergine hyd... CAS#:72786-12-0 |
| Literature: Stutz; Stadler; Vigouret; Jaton European Journal of Medicinal Chemistry, 1982 , vol. 17, # 6 p. 537 - 541 |
|
~%
Mesulergine hyd... CAS#:72786-12-0 |
| Literature: Stutz; Stadler; Vigouret; Jaton European Journal of Medicinal Chemistry, 1982 , vol. 17, # 6 p. 537 - 541 |
| N-(1,6-dimethylergolin-8a-yl)-N,N-dimethylsulfamide hydrochloride |
| mesulergin hydrochloride |
| CU 32-085 |
| Sulfamide,N'-((8alpha)-1,6-dimethylergolin-8-yl)-N,N-dimethyl-,monohydrochloride |
| Mesulergine hydrochloride |
| Mesulergine HCl |