1-Ethoxycarbonyl-beta-carboline structure
|
Common Name | 1-Ethoxycarbonyl-beta-carboline | ||
|---|---|---|---|---|
| CAS Number | 72755-19-2 | Molecular Weight | 240.25700 | |
| Density | 1.308±0.06 g/cm3 (20 ºC 760 Torr) | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2 | Melting Point | 145-146 ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-Ethoxycarbonyl-beta-carbolineKumujian A (1-Ethoxycarbonyl-β-carboline), an anti-inflammatory agent, inhibits both superoxide anion generation (IC50 = 4.87 μg/mL) and elastase release (IC50 = 6.29 μg/mL)[1]. |
| Name | 9H-β-carboline-1-carboxylic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Kumujian A (1-Ethoxycarbonyl-β-carboline), an anti-inflammatory agent, inhibits both superoxide anion generation (IC50 = 4.87 μg/mL) and elastase release (IC50 = 6.29 μg/mL)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.308±0.06 g/cm3 (20 ºC 760 Torr) |
|---|---|
| Melting Point | 145-146 ºC |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.25700 |
| Exact Mass | 240.09000 |
| PSA | 54.98000 |
| LogP | 2.89280 |
| InChIKey | CFXOOHNXLDSCHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nccc2c1[nH]c1ccccc12 |
| Water Solubility | Practically insoluble (0.021 g/L) (25 ºC) |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 1-ethoxycarbonyl-β-carboline |
| Kumujian A |
| ethyl 9H-pyrido[3,4-b]indole-1-carboxylate |
| ethyl β-carboline-1-carboxylate |
| Ethyl β-carboline-4-carboxylate |
| 1-Ethoxycarbonyl-beta-carboline |