ART-CHEM-BB B018178 structure
|
Common Name | ART-CHEM-BB B018178 | ||
|---|---|---|---|---|
| CAS Number | 725217-88-9 | Molecular Weight | 279.33300 | |
| Density | 1.26g/cm3 | Boiling Point | 372.2ºC at 760 mmHg | |
| Molecular Formula | C13H14FN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.9ºC | |
| Name | 3-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 372.2ºC at 760 mmHg |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.33300 |
| Flash Point | 178.9ºC |
| Exact Mass | 279.08400 |
| PSA | 78.74000 |
| LogP | 3.03190 |
| Index of Refraction | 1.598 |
| InChIKey | ZONDTQRLTAZGFU-UHFFFAOYSA-N |
| SMILES | C=CCn1c(C(C)Oc2ccc(F)cc2)n[nH]c1=S |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |