4-n-butoxynitrobenzene structure
|
Common Name | 4-n-butoxynitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 7244-78-2 | Molecular Weight | 195.21500 | |
| Density | 1.116g/cm3 | Boiling Point | 308ºC at 760 mmHg | |
| Molecular Formula | C10H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 31 °C | |
| Name | 1-Butoxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 308ºC at 760 mmHg |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.21500 |
| Flash Point | 31 °C |
| Exact Mass | 195.09000 |
| PSA | 55.05000 |
| LogP | 3.29690 |
| Index of Refraction | 1.522 |
| InChIKey | XCCDVVZINDJESR-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-butoxy-4-nitrobenzene |
| MFCD00024688 |