3,4,5-TRIBROMOBIPHENYL structure
|
Common Name | 3,4,5-TRIBROMOBIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 72416-87-6 | Molecular Weight | 390.89600 | |
| Density | 1.923g/cm3 | Boiling Point | 380ºC at 760 mmHg | |
| Molecular Formula | C12H7Br3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 178.3ºC | |
| Symbol |
GHS05, GHS07, GHS09 |
Signal Word | Danger | |
| Name | 1,3-dibromo-5-(4-bromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.923g/cm3 |
|---|---|
| Boiling Point | 380ºC at 760 mmHg |
| Molecular Formula | C12H7Br3 |
| Molecular Weight | 390.89600 |
| Flash Point | 178.3ºC |
| Exact Mass | 387.81000 |
| LogP | 5.64110 |
| Index of Refraction | 1.647 |
| InChIKey | PMLLBFUHDNYTAP-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2cc(Br)cc(Br)c2)cc1 |
| Symbol |
GHS05, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335-H410 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338-P501 |
| RIDADR | UN 3077 9 / PGIII |
|
~%
3,4,5-TRIBROMOB... CAS#:72416-87-6 |
| Literature: Case Journal of the American Chemical Society, 1939 , vol. 61, p. 3487,3489 |
|
~%
3,4,5-TRIBROMOB... CAS#:72416-87-6 |
| Literature: Bellavita Gazzetta Chimica Italiana, 1937 , vol. 67, p. 574,576 |
|
~%
3,4,5-TRIBROMOB... CAS#:72416-87-6 |
| Literature: Bellavita Gazzetta Chimica Italiana, 1937 , vol. 67, p. 574,576 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1-Biphenyl,3,4,5-tribromo |
| 3,5,4'-Tribrom-biphenyl |
| 3,4 inverted exclamation marka,5-Tribromobiphenyl |
| 3,4',5-TRIBROMO-1,1'-BIPHENYL |
| 3,5,4'-tribromo-biphenyl |