7,8-dimethyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione structure
|
Common Name | 7,8-dimethyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 72323-50-3 | Molecular Weight | 166.17700 | |
| Density | 1.21g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7,8-dimethyl-3,5-diazabicyclo[4.2.0]oct-7-ene-2,4-dione |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.17700 |
| Exact Mass | 166.07400 |
| PSA | 58.20000 |
| LogP | 0.81820 |
| Index of Refraction | 1.519 |
| InChIKey | VOECLLZEZABSKA-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C2C(=O)NC(=O)NC12 |
|
~55%
7,8-dimethyl-2,... CAS#:72323-50-3 |
| Literature: Kaminski, Victor V.; Comber, Robert N.; Wexler, Allan J.; Swenton, John S. Journal of Organic Chemistry, 1983 , vol. 48, # 14 p. 2337 - 2346 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |