3-methyl-4-nitrobenzhydrazide
Modify Date: 2025-08-25 18:37:45
3-methyl-4-nitrobenzhydrazide structure
|
Common Name | 3-methyl-4-nitrobenzhydrazide | ||
|---|---|---|---|---|
| CAS Number | 72198-83-5 | Molecular Weight | 195.17500 | |
| Density | 1.345g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O3 | Melting Point | 147-149°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-methyl-4-nitrobenzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.345g/cm3 |
|---|---|
| Melting Point | 147-149°C |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.17500 |
| Exact Mass | 195.06400 |
| PSA | 100.94000 |
| LogP | 2.12110 |
| Index of Refraction | 1.607 |
| InChIKey | SMRIMKXHORAHJR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)NN)ccc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,Xn |
| Risk Phrases | 36/37/38-22 |
| Safety Phrases | S26-S36/37/39-S36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2928000090 |
|
~80%
3-methyl-4-nitr... CAS#:72198-83-5 |
| Literature: ARES TRADING S.A.; QUATTROPANI, Anna; SWINNEN, Dominique Patent: WO2013/182274 A1, 2013 ; Location in patent: Page/Page column 47; 48 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-methyl-4-nitrobenzoylhydrazine |
| 3-Methyl-4-nitrobenzhydrazide |
| MFCD00220059 |
| 3-methyl-4-nitro-benzoic acid hydrazide |
| 2-methyl-1-nitrobenzene-4-carbohydrazide |
| 3-Methyl-4-nitro-benzoesaeure-hydrazid |
| 3-methyl-4-nitro-benzoyl hydrazide |