Ethanone,2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | Ethanone,2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 721-37-9 | Molecular Weight | 242.11800 | |
| Density | N/A | Boiling Point | 65ºC(24 torr) | |
| Molecular Formula | C9H4F6O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 139 °F | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | 2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 65ºC(24 torr) |
|---|---|
| Molecular Formula | C9H4F6O |
| Molecular Weight | 242.11800 |
| Flash Point | 139 °F |
| Exact Mass | 242.01700 |
| PSA | 17.07000 |
| LogP | 3.45040 |
| Index of Refraction | n20/D 1.415(lit.) |
| InChIKey | MDCHHRZBYSSONX-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | UN 1224 3/PG 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
The reduction of aryl trifluoromethyl ketones by N-carbamoylmethyl-1, 4-dihydronicotinamide. Stewart RK, et al.
Can. J. Chem. 58(23) , 2497-2503, (1980)
|
| 2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethan-1-one |
| 3-trifluoromethylphenyl trifluoromethyl ketone |
| MFCD00061275 |
| 2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone |
| 2,2,2-Trifluoro-1-[3-(Trifluoromethyl)Phenyl]-Ethanone |
| 3-Trifluoromethyltrifluoroacetophenone |