Serine Hydrolase Inhibitor-5
Modify Date: 2025-11-26 18:52:02
Serine Hydrolase Inhibitor-5 structure
|
Common Name | Serine Hydrolase Inhibitor-5 | ||
|---|---|---|---|---|
| CAS Number | 720664-62-0 | Molecular Weight | 387.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24F3N3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | Serine Hydrolase Inhibitor-5 |
|---|
| Molecular Formula | C18H24F3N3O3 |
|---|---|
| Molecular Weight | 387.4 |
| InChIKey | YPKAHRYADWTSGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | Missing Phrase - N15.00950417 |
| RIDADR | UN 2811 6.1 / PGIII |
|
Discovery libraries targeting the major enzyme classes: the serine hydrolases.
Bioorg. Med. Chem. Lett. 24(16) , 3807-13, (2014) Two libraries of modestly reactive ureas containing either electron-deficient acyl anilines or acyl pyrazoles were prepared and are reported as screening libraries for candidate serine hydrolase inhib... |