24-Epicastasterone structure
|
Common Name | 24-Epicastasterone | ||
|---|---|---|---|---|
| CAS Number | 72050-71-6 | Molecular Weight | 463.67000 | |
| Density | 1.127g/cm3 | Boiling Point | 598.7ºC at 760 mmHg | |
| Molecular Formula | C28H47O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.9ºC | |
Use of 24-Epicastasterone24-Epicastasterone (24-epi-Castasterone), a brassinosteroid, is a nature product that could be isolated from Hydrodictyon reticulatwn[1]. |
| Name | epicastasterone |
|---|---|
| Synonym | More Synonyms |
| Description | 24-Epicastasterone (24-epi-Castasterone), a brassinosteroid, is a nature product that could be isolated from Hydrodictyon reticulatwn[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 598.7ºC at 760 mmHg |
| Molecular Formula | C28H47O5 |
| Molecular Weight | 463.67000 |
| Flash Point | 329.9ºC |
| Exact Mass | 463.34200 |
| PSA | 97.99000 |
| LogP | 3.62020 |
| Index of Refraction | 1.541 |
| InChIKey | VYUIKSFYFRVQLF-QONPFPPSSA-N |
| SMILES | CC(C)C(C)C(O)C(O)C(C)C1CCC2C3CC(=O)C4CC(O)C(O)CC4(C)C3CCC12C |
| 22R,23R-28-Norbrassinolide |
| (1R,3aS,3bS,6aS,8S,9R,10aR,10bS,12aS)-1-[(1S,2R,3R)-2,3-dihydroxy-1,5-dimethylhexyl]hexadecahydro-8,9-dihydroxy-10a,12a-dimethyl-6H-benz[c]indeno[5,4-e]oxepin-6-one |
| 28-Nor Brassinolide |
| 24-epitasterone |
| 24-Demethylbrassinolide |
| (2|A,3|A,5|A,22R,23R)-2,3,22,23-Tetrahydroxy-B-homo-7-oxacholestan-6-one |