fmoc-gln-onp structure
|
Common Name | fmoc-gln-onp | ||
|---|---|---|---|---|
| CAS Number | 71989-21-4 | Molecular Weight | 489.47700 | |
| Density | 1.362 | Boiling Point | N/A | |
| Molecular Formula | C26H23N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) (2S)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362 |
|---|---|
| Molecular Formula | C26H23N3O7 |
| Molecular Weight | 489.47700 |
| Exact Mass | 489.15400 |
| PSA | 153.54000 |
| LogP | 5.28740 |
| InChIKey | KLCANCMZDAZCCW-QHCPKHFHSA-N |
| SMILES | NC(=O)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
|
~52%
fmoc-gln-onp CAS#:71989-21-4 |
| Literature: Atherton, Eric; Logan, Christopher J.; Sheppard, Robert C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 538 - 546 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Fmoc-L-glutamine 4-nitrophenyl ester |
| N-9-Fluorenylmethoxycarbonyl-L-asparagine 4-nitrophenyl ester |
| FMOC-GLUTAMINE-ONP |
| Fmoc-Gln-ONp |