Thielavin B
Modify Date: 2025-09-21 14:51:33
Thielavin B structure
|
Common Name | Thielavin B | ||
|---|---|---|---|---|
| CAS Number | 71950-67-9 | Molecular Weight | 566.59600 | |
| Density | 1.276g/cm3 | Boiling Point | 807.5ºC at 760 mmHg | |
| Molecular Formula | C31H34O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.1ºC | |
Use of Thielavin BThielavin B is an inhibitor of prostaglandin biosynthesis produced by Thielavia terricola. Thielavin B effectively influences the prostaglandin E2 synthesis from the endoperoxide. Thielavin B is significantly effective on carrageenan-induced oedema of rats when administered intravenously[1]. |
| Name | 4-[4-(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Thielavin B is an inhibitor of prostaglandin biosynthesis produced by Thielavia terricola. Thielavin B effectively influences the prostaglandin E2 synthesis from the endoperoxide. Thielavin B is significantly effective on carrageenan-induced oedema of rats when administered intravenously[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 807.5ºC at 760 mmHg |
| Molecular Formula | C31H34O10 |
| Molecular Weight | 566.59600 |
| Flash Point | 261.1ºC |
| Exact Mass | 566.21500 |
| PSA | 148.82000 |
| LogP | 5.71880 |
| Index of Refraction | 1.601 |
| InChIKey | UULGWGARYDGVBM-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(OC(=O)c2c(C)c(C)c(OC(=O)c3c(C)cc(O)c(C)c3O)c(C)c2OC)c(C)c(C)c1C(=O)O |
| Benzoic acid,4-((2,4-dihydroxy-3,6-dimethylbenzoyl)oxy)-2-methoxy-3,5,6-trimethyl-,4-carboxy-3-methoxy-2,5,6-trimethylphenyl ester |
| 4-({4-[(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy]-2-methoxy-3,5,6-trimethylbenzoyl}oxy)-2-methoxy-3,5,6-trimethylbenzoic acid |
| Thielavin B |