2,2',4,4',5,5'-hexachlorodiphenyl ether structure
|
Common Name | 2,2',4,4',5,5'-hexachlorodiphenyl ether | ||
|---|---|---|---|---|
| CAS Number | 71859-30-8 | Molecular Weight | 376.87800 | |
| Density | 1.626g/cm3 | Boiling Point | 390.5ºC at 760 mmHg | |
| Molecular Formula | C12H4Cl6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.5ºC | |
| Name | 1,2,4-trichloro-5-(2,4,5-trichlorophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.626g/cm3 |
|---|---|
| Boiling Point | 390.5ºC at 760 mmHg |
| Molecular Formula | C12H4Cl6O |
| Molecular Weight | 376.87800 |
| Flash Point | 137.5ºC |
| Exact Mass | 373.83900 |
| PSA | 9.23000 |
| LogP | 7.39930 |
| Index of Refraction | 1.626 |
| InChIKey | PECXRRMHOQBOIE-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(Oc2cc(Cl)c(Cl)cc2Cl)cc1Cl |
|
~%
2,2',4,4',5,5'-... CAS#:71859-30-8 |
| Literature: Nevalainen, Tapio; Rissanen, Kari Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 2 p. 271 - 280 |
| PCDE 153 |
| 2,2',4,4',5,5'-hexaCDE |
| 2,2',4,4',5,5'-Hexachlordiphenylether |
| 2,2',4,4',5,5'-Hexachlorobiphenyl ether |
| 2,2',4,4',5,5'-hexachlorodiphehyl ether |
| 2,2',4,4',5,5'-hexachlorodiphenylether |