5-Bromo-6-nitro-1H-indazole structure
|
Common Name | 5-Bromo-6-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 71785-49-4 | Molecular Weight | 242.030 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 389.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4±22.3 °C | |
| Name | 5-bromo-6-nitro-1h-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.6±22.0 °C at 760 mmHg |
| Molecular Formula | C7H4BrN3O2 |
| Molecular Weight | 242.030 |
| Flash Point | 189.4±22.3 °C |
| Exact Mass | 240.948685 |
| PSA | 74.50000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.764 |
| InChIKey | ATTOIRAMFAFXNA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2[nH]ncc2cc1Br |
| Storage condition | 2-8°C |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
|
~64%
5-Bromo-6-nitro... CAS#:71785-49-4 |
| Literature: Zhu, Gui-Dong; Gong, Jianchun; Gandhi, Viraj B.; Woods, Keith; Luo, Yan; Liu, Xuesong; Guan, Ran; Klinghofer, Vered; Johnson, Eric F.; Stoll, Vincent S.; Mamo, Mulugeta; Li, Qun; Rosenberg, Saul H.; Giranda, Vincent L. Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 6 p. 2441 - 2452 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Brom-6-nitroindazol |
| 1H-Indazole,5-broMo-6-nitro |
| 5-bromo-6-nitroindazole |
| 5-Bromo-6-nitro-1H-indazole |
| 1H-Indazole, 5-bromo-6-nitro- |