1-hydroxy-2-(4-methoxyphenyl)-6-phenylpyridin-4-one
Modify Date: 2025-08-31 21:31:34
1-hydroxy-2-(4-methoxyphenyl)-6-phenylpyridin-4-one structure
|
Common Name | 1-hydroxy-2-(4-methoxyphenyl)-6-phenylpyridin-4-one | ||
|---|---|---|---|---|
| CAS Number | 71637-94-0 | Molecular Weight | 293.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-hydroxy-2-(4-methoxyphenyl)-6-phenylpyridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15NO3 |
|---|---|
| Molecular Weight | 293.31700 |
| Exact Mass | 293.10500 |
| PSA | 51.46000 |
| LogP | 3.42820 |
| InChIKey | CRIFZSBDXDTYDG-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)cc(-c3ccccc3)n2O)cc1 |
|
~%
1-hydroxy-2-(4-... CAS#:71637-94-0 |
| Literature: Soliman; El-Kholy Journal of the Chemical Society, 1954 , p. 1755,1759 |
|
~%
1-hydroxy-2-(4-... CAS#:71637-94-0 |
| Literature: Soliman; El-Kholy Journal of the Chemical Society, 1954 , p. 1755,1759 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Phenyl-6-(4-methoxyphenyl)-1-hydroxy-4-pyridon |
| 1-hydroxy-2-(4-methoxy-phenyl)-6-phenyl-1H-pyridin-4-one |
| 4(1H)-Pyridinone,1-hydroxy-2-(4-methoxyphenyl)-6-phenyl |