3-Biphenylcarboxylic acid structure
|
Common Name | 3-Biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 716-76-7 | Molecular Weight | 198.217 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 392.2±21.0 °C at 760 mmHg | |
| Molecular Formula | C13H10O2 | Melting Point | 164-169 °C | |
| MSDS | Chinese USA | Flash Point | 177.3±16.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Biphenylcarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.2±21.0 °C at 760 mmHg |
| Melting Point | 164-169 °C |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.217 |
| Flash Point | 177.3±16.7 °C |
| Exact Mass | 198.068085 |
| PSA | 37.30000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | XNLWJFYYOIRPIO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(-c2ccccc2)c1 |
| Water Solubility | Insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | UN 3077 9 / PGIII |
| RTECS | TY3100000 |
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Biphenyl-3-carboxylic acid at 296 and 203 K.
Acta Crystallogr. C 52 ( Pt 9) , 2320-3, (1996) In biphenyl-3-carboxylic acid, C13H10O2, hydrogen bonding is of the cyclic-dimer type about a center of symmetry. The carboxyl H atom is ordered. The dihedral angle between the planar phenyl rings is ... |
| 3-Biphenylcarboxylic acid |
| Biphenyl-3-carboxylic acid |
| 3-phenylbenzoic acid |
| MFCD00045846 |
| EINECS 211-938-7 |
| [1,1'-Biphenyl]-3-carboxylic acid |