N,N-bis(2-methoxyphenyl)ethanimidamide structure
|
Common Name | N,N-bis(2-methoxyphenyl)ethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 7154-56-5 | Molecular Weight | 270.32600 | |
| Density | 1.06g/cm3 | Boiling Point | 444.9ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.9ºC | |
| Name | N,N'-bis-(2-methoxy-phenyl)-acetamidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 444.9ºC at 760 mmHg |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.32600 |
| Flash Point | 222.9ºC |
| Exact Mass | 270.13700 |
| PSA | 42.85000 |
| LogP | 3.93880 |
| Index of Refraction | 1.541 |
| InChIKey | KEQNNBXMFQMZOW-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N=C(C)Nc1ccccc1OC |
|
~65%
N,N-bis(2-metho... CAS#:7154-56-5 |
| Literature: Barluenga, Jose; Aznar, Fernando; Liz, Ramon; Rodes, Rosa Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 2732 - 2737 |
|
~%
N,N-bis(2-metho... CAS#:7154-56-5 |
| Literature: Taylor,E.C.; Ehrhart,W.A. Journal of Organic Chemistry, 1963 , vol. 28, p. 1108 - 1112 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| N1,N2-bis(2,6-dimethylphenyl)ethane-1,2-diamine |
| [(2-OCH3C6H5)NC(CH3)NH(2-OCH3C6H5)] |
| N,N'-di-(o-methoxyphenyl)acetamidine |
| N,N'-bis(2,6-dimethylphenyl)ethylenediamine |
| 1,2-bis(2',6'-dimethylphenyl-amino)-ethane |
| N,N'-Bis-(2,6-dimethyl-phenyl)-aethylendiamin |
| N.N'-Bis-<o-methoxy-phenyl>-acetamidin |
| N1,N2-bis(2-methoxyphenyl)acetamidine |
| (CH2)2[NH(2,6-dimethylphenyl)]2 |
| N,N'-Bis-(2-methoxy-phenyl)-acetamidin |