ethyl 2-(ethoxycarbonylmethylcarbamoylamino)acetate structure
|
Common Name | ethyl 2-(ethoxycarbonylmethylcarbamoylamino)acetate | ||
|---|---|---|---|---|
| CAS Number | 7150-63-2 | Molecular Weight | 232.23400 | |
| Density | 1.168g/cm3 | Boiling Point | 406.9ºC at 760 mmHg | |
| Molecular Formula | C9H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.9ºC | |
| Name | ethyl 2-[(2-ethoxy-2-oxoethyl)carbamoylamino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 406.9ºC at 760 mmHg |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.23400 |
| Flash Point | 199.9ºC |
| Exact Mass | 232.10600 |
| PSA | 93.73000 |
| LogP | 0.19360 |
| Index of Refraction | 1.46 |
| InChIKey | QJDUESMPRYWWDK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)NCC(=O)OCC |
| HS Code | 2924199090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-carbonyl-bis-glycine diethyl ester |
| diethyl N,N'-carbonylbisglycinate |
| diethyl 2,2'-ureylenediacetate |