(S)-Glycidyl tosylate structure
|
Common Name | (S)-Glycidyl tosylate | ||
|---|---|---|---|---|
| CAS Number | 70987-78-9 | Molecular Weight | 228.265 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 370.5±15.0 °C at 760 mmHg | |
| Molecular Formula | C10H12O4S | Melting Point | 45-48ºC | |
| MSDS | Chinese USA | Flash Point | 177.9±20.4 °C | |
| Symbol |
GHS05, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | (2S)-(+)-Glycidyl tosylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.5±15.0 °C at 760 mmHg |
| Melting Point | 45-48ºC |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.265 |
| Flash Point | 177.9±20.4 °C |
| Exact Mass | 228.045624 |
| PSA | 64.28000 |
| LogP | 1.35 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | NOQXXYIGRPAZJC-VIFPVBQESA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CO2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H318-H341-H350-H411 |
| Precautionary Statements | P201-P273-P280-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic |
| Risk Phrases | R41;R43;R45;R51/53 |
| Safety Phrases | S45-S53-S61 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | RR0510050 |
| Hazard Class | 9.0 |
| HS Code | 29109000 |
|
~%
(S)-Glycidyl to... CAS#:70987-78-9 |
| Literature: European Journal of Medicinal Chemistry, , vol. 62, p. 329 - 340 |
|
~%
(S)-Glycidyl to... CAS#:70987-78-9 |
| Literature: Journal of Organic Chemistry, , vol. 51, # 19 p. 3710 - 3712 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Henry, N. et al.
Tetrahedron Lett. 45 , 1465, (2004)
|
| (2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate |
| T3OTJ B1OSWR D1 &&S Form |
| EINECS 417-210-7 |
| [(2S)-oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| (2S)-Glycidyl tosylate |
| 2-Oxiranemethanol, 4-methylbenzenesulfonate, (2S)- |
| MFCD00064489 |
| (2S)-Oxiran-2-ylmethyl-4-methylbenzolsulfonat |
| (2S)-Oxiran-2-ylmethyl 4-methylbenzenesulfonate |
| (S)-Glycidyl tosylate |
| (S)-(+)-Glycidyl tosylate |