8-Dehydrocholesterol structure
|
Common Name | 8-Dehydrocholesterol | ||
|---|---|---|---|---|
| CAS Number | 70741-38-7 | Molecular Weight | 384.63800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H44O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 8-Dehydrocholesterol8-Dehydrocholesterol elevated concentration is one of the diagnostic biochemical hallmarks of classical Smith-Lemli-Opitz syndrome (SLOS). |
| Name | (3S,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | 8-Dehydrocholesterol elevated concentration is one of the diagnostic biochemical hallmarks of classical Smith-Lemli-Opitz syndrome (SLOS). |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Molecular Formula | C27H44O |
|---|---|
| Molecular Weight | 384.63800 |
| Exact Mass | 384.33900 |
| PSA | 20.23000 |
| LogP | 7.45290 |
| InChIKey | VUKORTMHZDZZFR-BXAZICILSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3=C(CCC21C)C1(C)CCC(O)CC1=CC3 |
| 8-Dehydrocholesterol |
| 8-DHC |
| 3b-Cholesta-5,8-dien-3-ol |
| Cholesta-5,8-dien-3beta-ol |