Kemptide (amide)
Modify Date: 2025-11-26 14:55:36
Kemptide (amide) structure
|
Common Name | Kemptide (amide) | ||
|---|---|---|---|---|
| CAS Number | 70691-36-0 | Molecular Weight | 770.92400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H62N14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Kemptide (amide)Kemptide (amide) is a heptapeptide with properties of a cytophilic substrate. Kemptide is a molecule preserving cell membrane intactness, is phosphorylated by PKI, the inhibitory protein specific for cAMP-dependent protein kinase (PK)[1]. |
| Name | kemptamide |
|---|---|
| Synonym | More Synonyms |
| Description | Kemptide (amide) is a heptapeptide with properties of a cytophilic substrate. Kemptide is a molecule preserving cell membrane intactness, is phosphorylated by PKI, the inhibitory protein specific for cAMP-dependent protein kinase (PK)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H62N14O8 |
|---|---|
| Molecular Weight | 770.92400 |
| Exact Mass | 770.48800 |
| PSA | 387.74000 |
| LogP | 1.09800 |
| InChIKey | GSFASBKOFCRMBR-LLINQDLYSA-N |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NCC(N)=O |
| (S)-2-Amino-4-methyl-pentanoic acid {(S)-1-[(S)-1-((S)-1-{(S)-1-[(S)-1-(carbamoylmethyl-carbamoyl)-3-methyl-butylcarbamoyl]-2-hydroxy-ethylcarbamoyl}-ethylcarbamoyl)-4-guanidino-butylcarbamoyl]-4-guanidino-butyl}-amide |