boc-(r)-alpha-(4-fluorobenzyl)-proline structure
|
Common Name | boc-(r)-alpha-(4-fluorobenzyl)-proline | ||
|---|---|---|---|---|
| CAS Number | 706806-64-6 | Molecular Weight | 323.35900 | |
| Density | 1.242g/cm3 | Boiling Point | 447.4ºC at 760 mmHg | |
| Molecular Formula | C17H22FNO4 | Melting Point | 70-72℃ | |
| MSDS | Chinese USA | Flash Point | 224.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2R)-2-[(4-fluorophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 447.4ºC at 760 mmHg |
| Melting Point | 70-72℃ |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.35900 |
| Flash Point | 224.4ºC |
| Exact Mass | 323.15300 |
| PSA | 66.84000 |
| LogP | 3.16040 |
| Index of Refraction | 1.543 |
| InChIKey | AWTXCFLBYUGCEW-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1(Cc1ccc(F)cc1)C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |