N-(2-benzoyl-4-bromophenyl)-5-(2-chloro-4-nitrophenyl)furan-2-carboxamide
Modify Date: 2025-09-23 20:12:05
N-(2-benzoyl-4-bromophenyl)-5-(2-chloro-4-nitrophenyl)furan-2-carboxamide structure
|
Common Name | N-(2-benzoyl-4-bromophenyl)-5-(2-chloro-4-nitrophenyl)furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 7061-88-3 | Molecular Weight | 525.73500 | |
| Density | 1.571g/cm3 | Boiling Point | 606ºC at 760mmHg | |
| Molecular Formula | C24H14BrClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.3ºC | |
| Name | N-(2-benzoyl-4-bromophenyl)-5-(2-chloro-4-nitrophenyl)furan-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.571g/cm3 |
|---|---|
| Boiling Point | 606ºC at 760mmHg |
| Molecular Formula | C24H14BrClN2O5 |
| Molecular Weight | 525.73500 |
| Flash Point | 320.3ºC |
| Exact Mass | 523.97700 |
| PSA | 105.13000 |
| LogP | 7.35020 |
| Index of Refraction | 1.681 |
| InChIKey | KCUZMYOGLQRWQR-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Br)cc1C(=O)c1ccccc1)c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
|
~%
N-(2-benzoyl-4-... CAS#:7061-88-3 |
| Literature: Le Fevre Journal of the Chemical Society, 1930 , p. 147,149 |
|
~%
N-(2-benzoyl-4-... CAS#:7061-88-3 |
| Literature: Le Fevre Journal of the Chemical Society, 1930 , p. 147,149 |
|
~%
N-(2-benzoyl-4-... CAS#:7061-88-3 |
| Literature: Le Fevre Journal of the Chemical Society, 1930 , p. 147,149 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-dipicryl-piperazine |
| 1,4-Dipicryl-piperazin |
| 1,4-Bis-<2,4,6-trinitro-phenyl>-piperazin |
| 1,4-bis-(2,4,6-trinitro-phenyl)-piperazine |