l-histidine monohydrochloride monohydrate structure
|
Common Name | l-histidine monohydrochloride monohydrate | ||
|---|---|---|---|---|
| CAS Number | 7048-02-4 | Molecular Weight | 209.63100 | |
| Density | 1.204g/cm3 | Boiling Point | 553.9ºC at 760 mmHg | |
| Molecular Formula | C6H12ClN3O3 | Melting Point | 240-245ºC(dec.) | |
| MSDS | N/A | Flash Point | 239.9ºC | |
| Name | l-histidine monohydrochloride monohydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 553.9ºC at 760 mmHg |
| Melting Point | 240-245ºC(dec.) |
| Molecular Formula | C6H12ClN3O3 |
| Molecular Weight | 209.63100 |
| Flash Point | 239.9ºC |
| Exact Mass | 209.05700 |
| PSA | 101.23000 |
| LogP | 0.80210 |
| Index of Refraction | 1.611 |
| InChIKey | CMXXUDSWGMGYLZ-UHFFFAOYSA-N |
| SMILES | Cl.NC(Cc1cnc[nH]1)C(=O)O.O |
| Water Solubility | H2O: 100 mg/mL |
| Safety Phrases | S22-S24/25 |
|---|---|
| WGK Germany | 3 |
| RTECS | MS3119000 |
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00151027 |
| EINECS 211-438-9 |