Benzeneacetic acid,4-(difluoromethoxy)-a-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester structure
|
Common Name | Benzeneacetic acid,4-(difluoromethoxy)-a-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester | ||
|---|---|---|---|---|
| CAS Number | 70124-77-5 | Molecular Weight | 451.46200 | |
| Density | 1.219 | Boiling Point | 545.1ºC at 760 mmHg | |
| Molecular Formula | C26H23F2NO4 | Melting Point | <25℃ | |
| MSDS | Chinese USA | Flash Point | -18 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | flucythrinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219 |
|---|---|
| Boiling Point | 545.1ºC at 760 mmHg |
| Melting Point | <25℃ |
| Molecular Formula | C26H23F2NO4 |
| Molecular Weight | 451.46200 |
| Flash Point | -18 °C |
| Exact Mass | 451.16000 |
| PSA | 68.55000 |
| LogP | 6.62798 |
| Index of Refraction | 1.553 |
| InChIKey | GBIHOLCMZGAKNG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H331-H312-H410 |
| Precautionary Statements | P261-P273-P280-P301 + P310-P311-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N,Xn,F |
| Risk Phrases | R20/21 |
| Safety Phrases | S36/37-S45-S60-S61-S62 |
| RIDADR | UN 2810 6.1/PG 3 |
| RTECS | CY1578620 |
| Hazard Class | 3.0 |
| HS Code | 2926909037 |
| HS Code | 2926909037 |
|---|
|
Dislodgable insecticide residues on cotton foliage: acephate, AC 222,705, EPN, fenvalerate, methomyl, methyl parathion, permethrin, and thiodicarb.
Bull. Environ. Contam. Toxicol. 25(4) , 608-15, (1980)
|
|
|
Investigation of the photochemical behaviour of pyrethroids lacking the cyclopropane ring by photo-solid-phase microextraction and gas chromatography/mass spectrometry.
Rapid Commun. Mass Spectrom. 23(23) , 3673-87, (2009) The characterization of by-products arising from the UV photodegradation of two insecticide pyrethroids lacking the cyclopropane ring (flucythrinate and fenvalerate) has been investigated by gas chrom... |
|
|
Comparison of dislodgable and total residues of three pyrethroids applied to cotton in Arizona.
Bull. Environ. Contam. Toxicol. 44(2) , 240-5, (1990)
|
| EINECS 274-322-7 |
| Cythrin |
| Caswell No. 002AA |
| Pay Off |
| Fluorocythrin |
| (Ξ)-cyano(3-phenoxyphenyl)methyl (2S)-2-[4-(difluoromethoxy)phenyl]-3-methylbutanoate |
| FLUCYTHRINATE |
| cyano(3-phenoxyphenyl)methyl (αS)-4-(difluoromethoxy)-α-(1-methylethyl)benzeneacetate |
| Funchiong jujr |
| MFCD00137383 |
| CyBolt |
| Guardian |
| [cyano-(3-phenoxyphenyl)methyl] 2-[4-(difluoromethoxy)phenyl]-3-methylbutanoate |
| Stock Guard |
| (RS)-α-cyano-3-phenoxybenzyl (S)-2-(4-difluoromethoxyphenyl)-3-methylbutyrate |