Ethyl (2-formyl-6-methoxyphenoxy)acetate
Modify Date: 2025-11-25 07:33:50
Ethyl (2-formyl-6-methoxyphenoxy)acetate structure
|
Common Name | Ethyl (2-formyl-6-methoxyphenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 70076-67-4 | Molecular Weight | 238.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl (2-formyl-6-methoxyphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O5 |
|---|---|
| Molecular Weight | 238.23700 |
| Exact Mass | 238.08400 |
| PSA | 61.83000 |
| LogP | 1.44960 |
| InChIKey | RGWBICWDTDHCGS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1c(C=O)cccc1OC |
| HS Code | 2918990090 |
|---|
|
~86%
Ethyl (2-formyl... CAS#:70076-67-4 |
| Literature: Verhe; De Kimpe; De Buyck; et al. Bulletin des Societes Chimiques Belges, 1980 , vol. 89, # 6 p. 459 - 485 |
|
~%
Ethyl (2-formyl... CAS#:70076-67-4 |
| Literature: v.Stockalper Jb.phil.Fak.II Univ.Bern, 1924 , vol. 4, p. 27 |
CAS#:50551-58-1
CAS#:40359-30-6| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-ethoxycarbonylmethoxy-3-methoxybenzaldehyde |
| (2-Formyl-6-methoxy-phenoxy)-essigsaeure-aethylester |
| (2-formyl-6-methoxyphenoxy)acetic acid |
| ethyl 2-(2-formyl-6-methoxyphenoxy)acetate |
| (2-formyl-6-methoxy-phenoxy)-acetic acid ethyl ester |
| (2-Formyl-6-methoxy-phenoxy)-essigsaeure |