(4-BROMO-1-METHYL-1H-PYRAZOL-3-YL)METHYLAMINE
Modify Date: 2025-11-27 06:07:33
(4-BROMO-1-METHYL-1H-PYRAZOL-3-YL)METHYLAMINE structure
|
Common Name | (4-BROMO-1-METHYL-1H-PYRAZOL-3-YL)METHYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 20037-36-9 | Molecular Weight | 317.13300 | |
| Density | 1.452g/cm3 | Boiling Point | 391.3ºC at 760 mmHg | |
| Molecular Formula | C12H13BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.5ºC | |
| Name | ethyl 2-(4-bromo-2-formyl-6-methoxyphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 391.3ºC at 760 mmHg |
| Molecular Formula | C12H13BrO5 |
| Molecular Weight | 317.13300 |
| Flash Point | 190.5ºC |
| Exact Mass | 315.99500 |
| PSA | 61.83000 |
| LogP | 2.21210 |
| Vapour Pressure | 2.48E-06mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | CDFJGOAIKJRSEA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1c(C=O)cc(Br)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl (4-bromo-2-formyl-6-methoxyphenoxy)acetate |
| <4-Brom-2-formyl-6-methoxy-phenoxy>-essigsaeure-aethylester |
| HMS2391I07 |