Ethanone,1-[4-[(2,2,2-trichloro-1-hydroxyethyl)amino]phenyl]- structure
|
Common Name | Ethanone,1-[4-[(2,2,2-trichloro-1-hydroxyethyl)amino]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 69796-31-2 | Molecular Weight | 282.55100 | |
| Density | 1.494g/cm3 | Boiling Point | 433.6ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216ºC | |
| Name | 1-[4-[(2,2,2-trichloro-1-hydroxyethyl)amino]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.494g/cm3 |
|---|---|
| Boiling Point | 433.6ºC at 760 mmHg |
| Molecular Formula | C10H10Cl3NO2 |
| Molecular Weight | 282.55100 |
| Flash Point | 216ºC |
| Exact Mass | 280.97800 |
| PSA | 49.33000 |
| LogP | 3.06270 |
| Index of Refraction | 1.621 |
| InChIKey | ALWIGMXNPDEQAW-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NC(O)C(Cl)(Cl)Cl)cc1 |
|
~%
Ethanone,1-[4-[... CAS#:69796-31-2 |
| Literature: Sumerford; Dalton Journal of Organic Chemistry, 1944 , vol. 9, p. 81,82 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Acetophenone,2,2-trichloro-1-hydroxyethyl)amino] |
| 1-[4-(2,2,2-trichloro-1-hydroxy-ethylamino)-phenyl]-ethanone |
| 1-[4-(2,2,2-Trichlor-1-hydroxy-aethylamino)-phenyl]-aethanon |
| Ethanone,2,2-trichloro-1-hydroxyethyl)amino]phenyl] |