4-nitro-1-phenoxy-2-(trifluoromethyl)benzene
Modify Date: 2025-08-24 22:22:06
4-nitro-1-phenoxy-2-(trifluoromethyl)benzene structure
|
Common Name | 4-nitro-1-phenoxy-2-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 6969-95-5 | Molecular Weight | 283.20300 | |
| Density | 1.378g/cm3 | Boiling Point | 302.4ºC at 760 mmHg | |
| Molecular Formula | C13H8F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.7ºC | |
| Name | 4-nitro-1-phenoxy-2-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 302.4ºC at 760 mmHg |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.20300 |
| Flash Point | 136.7ºC |
| Exact Mass | 283.04600 |
| PSA | 55.05000 |
| LogP | 4.92910 |
| Index of Refraction | 1.537 |
| InChIKey | VISZAKUAHVQLIE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccccc2)c(C(F)(F)F)c1 |
|
~89%
4-nitro-1-pheno... CAS#:6969-95-5 |
| Literature: Yang, Fengchun; Li, Yanfeng; Ma, Tao; Bu, Qianqian; Zhang, Shujiang Journal of Fluorine Chemistry, 2010 , vol. 131, # 7 p. 767 - 775 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-trifluoromethyl-5-nitro-2-phenoxy-benzene |