1H-Inden-1-one,2,3-dihydro-7-hydroxy-2-(phenylmethylene)- structure
|
Common Name | 1H-Inden-1-one,2,3-dihydro-7-hydroxy-2-(phenylmethylene)- | ||
|---|---|---|---|---|
| CAS Number | 69676-26-2 | Molecular Weight | 236.26500 | |
| Density | 1.303g/cm3 | Boiling Point | 452.5ºC at 760mmHg | |
| Molecular Formula | C16H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.7ºC | |
| Name | 2-benzylidene-7-hydroxy-3H-inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 452.5ºC at 760mmHg |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.26500 |
| Flash Point | 192.7ºC |
| Exact Mass | 236.08400 |
| PSA | 37.30000 |
| LogP | 3.21460 |
| Index of Refraction | 1.713 |
| InChIKey | BEUKSOLRWLXYDB-UHFFFAOYSA-N |
| SMILES | O=C1C(=Cc2ccccc2)Cc2cccc(O)c21 |
|
~60%
1H-Inden-1-one,... CAS#:69676-26-2 |
| Literature: Sarbagya, D. P.; Rangachari, K.; Mazumdar, A. K. D.; Banerji, K. D. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 891 - 893 |
|
~%
1H-Inden-1-one,... CAS#:69676-26-2 |
| Literature: Salem; Richter; Hitzler; Chiba; Ecker Scientia Pharmaceutica, 1998 , vol. 66, # 3 p. 147 - 158 |
|
~%
1H-Inden-1-one,... CAS#:69676-26-2 |
| Literature: Mayer; van Zuetphen Chemische Berichte, 1924 , vol. 57, p. 202,618 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Benzyliden-7-hydroxy-indan-1-on |
| 2-Benzal-7-hydroxy-indanon |
| 2-benzylidene-7-hydroxy-indan-1-one |
| 2-Benzyliden-6-(4-methyl-benzyliden)-cyclohexanon |
| Cyclohexanone,2-[(4-methylphenyl)methylene]-6-(phenylmethylene) |
| 2-benzylidene-6-(4-methyl-benzylidene)-cyclohexanone |