Phosphonium,[2-(acetylamino)-9H-fluoren-9-yl]triphenyl-, bromide (1:1) structure
|
Common Name | Phosphonium,[2-(acetylamino)-9H-fluoren-9-yl]triphenyl-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6954-74-1 | Molecular Weight | 564.45100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H27BrNOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-acetamido-9H-fluoren-9-yl)-triphenylphosphanium,bromide |
|---|
| Molecular Formula | C33H27BrNOP |
|---|---|
| Molecular Weight | 564.45100 |
| Exact Mass | 563.10100 |
| PSA | 42.69000 |
| LogP | 3.78590 |
| InChIKey | BGCNXZVRAQLVIX-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2c(c1)C([P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1-2.[Br-] |
|
~%
Phosphonium,[2-... CAS#:6954-74-1 |
| Literature: Johnson,A.W. et al. Journal of the American Chemical Society, 1966 , vol. 88, # 9 p. 1953 - 1958 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |