2-Quinolinemethanol,6-methoxy-a-methyl-a-phenyl-
Modify Date: 2025-09-18 12:48:28
2-Quinolinemethanol,6-methoxy-a-methyl-a-phenyl- structure
|
Common Name | 2-Quinolinemethanol,6-methoxy-a-methyl-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 6949-90-2 | Molecular Weight | 279.33300 | |
| Density | 1.188g/cm3 | Boiling Point | 452.9ºC at 760 mmHg | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | 1-(6-methoxyquinolin-2-yl)-1-phenylethanol |
|---|
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 452.9ºC at 760 mmHg |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.33300 |
| Flash Point | 227.7ºC |
| Exact Mass | 279.12600 |
| PSA | 42.35000 |
| LogP | 3.49920 |
| Index of Refraction | 1.632 |
| InChIKey | BBENASZCLZZBGB-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(C(C)(O)c3ccccc3)ccc2c1 |
| HS Code | 2933499090 |
|---|
|
~%
2-Quinolinemeth... CAS#:6949-90-2 |
| Literature: Wolf et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 861,868 |
|
~%
2-Quinolinemeth... CAS#:6949-90-2 |
| Literature: Wolf et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 861,868 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |