(2-formyl-6-methoxy-4-methyl-phenyl) acetate
Modify Date: 2025-08-25 12:21:14
(2-formyl-6-methoxy-4-methyl-phenyl) acetate structure
|
Common Name | (2-formyl-6-methoxy-4-methyl-phenyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 7148-95-0 | Molecular Weight | 208.21100 | |
| Density | 1.163g/cm3 | Boiling Point | 304.8ºC at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.4ºC | |
| Name | (2-formyl-6-methoxy-4-methylphenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 304.8ºC at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 132.4ºC |
| Exact Mass | 208.07400 |
| PSA | 52.60000 |
| LogP | 1.74140 |
| Index of Refraction | 1.536 |
| InChIKey | BMYOCRLRSVEJRP-UHFFFAOYSA-N |
| SMILES | COc1cc(C)cc(C=O)c1OC(C)=O |
|
~%
(2-formyl-6-met... CAS#:7148-95-0 |
| Literature: Browne; Shriner Journal of Organic Chemistry, 1957 , vol. 22, p. 1320 |
|
~%
(2-formyl-6-met... CAS#:7148-95-0 |
| Literature: Li, Shiming; Lundquist, Knut; Stomberg, Rolf Acta Crystallographica Section C: Crystal Structure Communications, 1999 , vol. 55, # 6 p. 1012 - 1014 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-acetoxy-3-methoxy-5-methylbenzaldehyde |
| 2-Acetoxy-3-methoxy-5-methyl-benzaldehyd |
| 2-formyl-6-methoxy-4-methylphenyl acetate |