1H-Indole-3-aceticacid, 2,6,7-trimethyl-
Modify Date: 2025-08-25 16:00:22
1H-Indole-3-aceticacid, 2,6,7-trimethyl- structure
|
Common Name | 1H-Indole-3-aceticacid, 2,6,7-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 6949-72-0 | Molecular Weight | 217.26400 | |
| Density | 1.219g/cm3 | Boiling Point | 425ºC at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.8ºC | |
| Name | 2,6,7-Trimethyl-chroman-4-on-oxim |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 425ºC at 760 mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 210.8ºC |
| Exact Mass | 217.11000 |
| PSA | 53.09000 |
| LogP | 2.72020 |
| Index of Refraction | 1.639 |
| InChIKey | ULGYSCIYCHOGKV-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(CC(=O)O)c(C)[nH]c2c1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4H-1-Benzopyran-4-one,2,3-dihydro-2,6,7-trimethyl-,oxime |
| 2,6,7-Trimethyl-indolyl-(3)-essigsaeure |
| (2,6,7-trimethyl-indol-3-yl)-acetic acid |
| 2,6,7-trimethyl-chroman-4-one oxime |