1H-Indole-3-aceticacid,7-chloro-(9CI) structure
|
Common Name | 1H-Indole-3-aceticacid,7-chloro-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 1912-41-0 | Molecular Weight | 209.62900 | |
| Density | 1.483g/cm3 | Boiling Point | 445.6ºC at 760mmHg | |
| Molecular Formula | C10H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
| Name | 7-chloroindole-3-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.483g/cm3 |
|---|---|
| Boiling Point | 445.6ºC at 760mmHg |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.62900 |
| Flash Point | 223.3ºC |
| Exact Mass | 209.02400 |
| PSA | 53.09000 |
| LogP | 2.44840 |
| Vapour Pressure | 1.01E-08mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | IFOAZUXPPBRTBS-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1c[nH]c2c(Cl)cccc12 |
| HS Code | 2933990090 |
|---|
|
~%
1H-Indole-3-ace... CAS#:1912-41-0 |
| Literature: Rossiter, Sharon; Folkes, Lisa K.; Wardman, Peter Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 18 p. 2523 - 2526 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Chloroindole-3-acetic acid |
| 1H-Indole-3-aceticacid,7-chloro |
| Indole-3-acetic acid,7-chloro |
| 2-(7-chloro-1H-indol-3-yl)acetic acid |
| (7-chloro-indol-3-yl)-acetic acid |
| 7-Chlor-3-indolylessigsaeure |
| (7-Chlor-indol-3-yl)-essigsaeure |