Ethanol, 2-ethoxy-,1-(3,5-dinitrobenzoate) structure
|
Common Name | Ethanol, 2-ethoxy-,1-(3,5-dinitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 6943-77-7 | Molecular Weight | 284.22200 | |
| Density | 1.373g/cm3 | Boiling Point | 386.2ºC at 760mmHg | |
| Molecular Formula | C11H12N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.2ºC | |
| Name | 2-ethoxyethyl 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 386.2ºC at 760mmHg |
| Molecular Formula | C11H12N2O7 |
| Molecular Weight | 284.22200 |
| Flash Point | 164.2ºC |
| Exact Mass | 284.06400 |
| PSA | 127.17000 |
| LogP | 2.74270 |
| Index of Refraction | 1.558 |
| InChIKey | SCXGAVJIYIXEAJ-UHFFFAOYSA-N |
| SMILES | CCOCCOC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~%
Ethanol, 2-etho... CAS#:6943-77-7 |
|
Literature: Vogel,A.I. Text-Book of Practical Organic Chemistry, 1. Aufl. |
|
~%
Ethanol, 2-etho... CAS#:6943-77-7 |
| Literature: Gladkovskii,G.A.; Skorokhodov,S.S. Journal of Organic Chemistry USSR (English Translation), 1967 , vol. 3, p. 628 - 633 Zhurnal Organicheskoi Khimii, 1967 , vol. 3, p. 657 - 663 |
| 3,5-Dinitro-benzoesaeure-<2-ethoxy-ethylester> |