Methyl 2-bromo-5-nitrobenzoate structure
|
Common Name | Methyl 2-bromo-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 6942-36-5 | Molecular Weight | 260.042 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 326.7±22.0 °C at 760 mmHg | |
| Molecular Formula | C8H6BrNO4 | Melting Point | 79-81 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 151.4±22.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Methyl 2-bromo-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.7±22.0 °C at 760 mmHg |
| Melting Point | 79-81 °C(lit.) |
| Molecular Formula | C8H6BrNO4 |
| Molecular Weight | 260.042 |
| Flash Point | 151.4±22.3 °C |
| Exact Mass | 258.947998 |
| PSA | 72.12000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | VSEYYEKRZNRECT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~96%
Methyl 2-bromo-... CAS#:6942-36-5 |
| Literature: Kawabata, Takeo; Jiang, Changsheng; Hayashi, Kazuhiro; Tsubaki, Kazunori; Yoshimura, Tomoyuki; et al. Journal of the American Chemical Society, 2009 , vol. 131, p. 54 - 55 |
|
~%
Methyl 2-bromo-... CAS#:6942-36-5 |
| Literature: US6894174 B1, ; Page/Page column 15 ; |
|
~97%
Methyl 2-bromo-... CAS#:6942-36-5 |
| Literature: Dydio, Pawel; Reek, Joost N. H. Angewandte Chemie - International Edition, 2013 , vol. 52, # 14 p. 3878 - 3882 Angew. Chem., 2013 , vol. 125, # 14 p. 4132 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| WNR DE CVO2 |
| Methyl 2-bromo-5-nitrobenzoate |
| 2-Bromo-5-nitrobenzoic acid methyl ester |
| MFCD00010867 |
| Benzoic acid, 2-bromo-5-nitro-, methyl ester |