3-amino-4-(oxolan-2-ylmethylamino)benzoic acid
Modify Date: 2025-09-01 15:25:30
3-amino-4-(oxolan-2-ylmethylamino)benzoic acid structure
|
Common Name | 3-amino-4-(oxolan-2-ylmethylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 693812-83-8 | Molecular Weight | 236.26700 | |
| Density | 1.316g/cm3 | Boiling Point | 475.4ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | 3-amino-4-(oxolan-2-ylmethylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760 mmHg |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.26700 |
| Flash Point | 241.3ºC |
| Exact Mass | 236.11600 |
| PSA | 84.58000 |
| LogP | 2.21210 |
| Index of Refraction | 1.645 |
| InChIKey | NOQZJPNPEJXAFH-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(=O)O)ccc1NCC1CCCO1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| hms1556f17 |