3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
Modify Date: 2025-08-21 16:03:03
![3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid Structure](https://image.chemsrc.com/caspic/035/954238-52-9.png)
3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid structure
|
Common Name | 3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 954238-52-9 | Molecular Weight | 252.266 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 381.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.3±26.5 °C | |
| Name | 3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 381.0±37.0 °C at 760 mmHg |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.266 |
| Flash Point | 184.3±26.5 °C |
| Exact Mass | 252.111008 |
| PSA | 105.14000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | LHKSERFGEFCORM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)C(=O)O)N |
| HS Code | 2924299090 |
|---|
|
~81%
3-amino-4-[(2-m... CAS#:954238-52-9 |
| Literature: ACADEMIA SINICA; YANG, Wen-Bin Patent: US2013/102049 A1, 2013 ; Location in patent: Page/Page column ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Amino-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid |
| Benzoic acid, 3-amino-4-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| N-Boc-3,4-diaminobenzoic acid |