fluazifop
fluazifop structure
|
Common Name | fluazifop | ||
|---|---|---|---|---|
| CAS Number | 69335-91-7 | Molecular Weight | 327.25500 | |
| Density | 1.37g/cm3 | Boiling Point | 429.9ºC at 760 mmHg | |
| Molecular Formula | C15H12F3NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 213.8ºC | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | fluazifop |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 429.9ºC at 760 mmHg |
| Molecular Formula | C15H12F3NO4 |
| Molecular Weight | 327.25500 |
| Flash Point | 213.8ºC |
| Exact Mass | 327.07200 |
| PSA | 68.65000 |
| LogP | 3.74460 |
| Vapour Pressure | 3.71E-08mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | YUVKUEAFAVKILW-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1)C(=O)O |
| Storage condition | APPROX 4°C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H319-H336 |
| Supplemental HS | Repeated exposure may cause skin dryness or cracking. |
| Precautionary Statements | P210-P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi,Xn |
| Risk Phrases | 11-36-66-67-20/21/22-50/53-63 |
| Safety Phrases | 26-36/37-16-61-60-33 |
| RIDADR | UN 1173 3/PG 2 |
| RTECS | UA2935000 |
|
~%
fluazifop CAS#:69335-91-7 |
| Literature: US5199970 A1, ; |
![4-{[5-(TRIFLUOROMETHYL)PYRIDIN-2-YL]OXY}PHENOL structure](https://image.chemsrc.com/caspic/275/69045-85-8.png)
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:69335-90-6|
Inhibitors of nonhousekeeping functions of the apicoplast defy delayed death in Plasmodium falciparum.
Antimicrob. Agents Chemother. 51 , 307-16, (2007) Targeting of apicoplast replication and protein synthesis in the apicomplexan Toxoplasma gondii has conventionally been associated with the typical "delayed death" phenotype, characterized by the deat... |
|
|
Trypanosoma brucei: inhibition of acetyl-CoA carboxylase by haloxyfop.
Exp. Parasitol. 130(2) , 159-65, (2012) Trypanosoma brucei, a eukaryotic pathogen that causes African sleeping sickness in humans and nagana in cattle, depends on the enzyme acetyl-CoA carboxylase (ACC) for full virulence in mice. ACC produ... |
|
|
Characterisation of target-site resistance to ACCase-inhibiting herbicides in the weed Alopecurus myosuroides (black-grass).
Pest Manag. Sci. 59(2) , 190-201, (2003) Resistance to aryloxyphenoxypropionate (AOPP), cyclohexanedione (CHD) and phenylurea herbicides was determined in UK populations of Alopecurus myosuroides Huds. Two populations (Oxford AA1, Notts. A1)... |
| 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid |
| 2-[4-(5-trifluoromethyl-pyridin-2-yloxy)-phenoxy]propionic acid |
| 2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionic acid |
| (RS)-Fluazifop |
| (RS)-2-{4-[5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionic acid |
| FLUAZIFOP |
| rac-(2R)-2-{4-([5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid |
| 2-<4-(5-pyrimidinyl)butyl>-1H-isoindole-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione,2-[4-(5-pyrimidinyl)butyl] |