bis[(benzo-15-crown-5)-15-ylmethyl] pimelate
Modify Date: 2025-08-25 22:20:15
![bis[(benzo-15-crown-5)-15-ylmethyl] pimelate Structure](https://image.chemsrc.com/caspic/461/69271-98-3.png)
bis[(benzo-15-crown-5)-15-ylmethyl] pimelate structure
|
Common Name | bis[(benzo-15-crown-5)-15-ylmethyl] pimelate | ||
|---|---|---|---|---|
| CAS Number | 69271-98-3 | Molecular Weight | 720.80000 | |
| Density | 1.146g/cm3 | Boiling Point | 798.3ºC at 760 mmHg | |
| Molecular Formula | C37H52O14 | Melting Point | 81-84ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 320.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl) heptanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 798.3ºC at 760 mmHg |
| Melting Point | 81-84ºC(lit.) |
| Molecular Formula | C37H52O14 |
| Molecular Weight | 720.80000 |
| Flash Point | 320.7ºC |
| Exact Mass | 720.33600 |
| PSA | 144.90000 |
| LogP | 4.06570 |
| Index of Refraction | 1.493 |
| InChIKey | LTZRCLYZVSXCTC-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCC(=O)OCc1ccc2c(c1)OCCOCCOCCOCCO2)OCc1ccc2c(c1)OCCOCCOCCOCCO2 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Kimura, K., et al.
J. Electroanal. Chem. Interfac. Electrochem. 95 , 91, (1979)
|
|
|
H. Tamura et al.
Mikrochim. Acta II , 287, (1983)
|
| MFCD00012089 |
| potassium ionophore II |