tris-(3,5-Dimethylphenyl)phosphine structure
|
Common Name | tris-(3,5-Dimethylphenyl)phosphine | ||
|---|---|---|---|---|
| CAS Number | 69227-47-0 | Molecular Weight | 346.44500 | |
| Density | N/A | Boiling Point | 474.1ºC at 760 mmHg | |
| Molecular Formula | C24H27P | Melting Point | 161-164ºC | |
| MSDS | Chinese USA | Flash Point | 255ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Tris(3,5-dimethylphenyl)phosphine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 474.1ºC at 760 mmHg |
|---|---|
| Melting Point | 161-164ºC |
| Molecular Formula | C24H27P |
| Molecular Weight | 346.44500 |
| Flash Point | 255ºC |
| Exact Mass | 346.18500 |
| PSA | 13.59000 |
| LogP | 5.29520 |
| InChIKey | XRALRSQLQXKXKP-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 29310099 |
|
~53%
tris-(3,5-Dimet... CAS#:69227-47-0 |
| Literature: Culcasi, Marcel; Berchadsky, Yves; Gronchi, Gerard; Tordo, Paul Journal of Organic Chemistry, 1991 , vol. 56, # 11 p. 3537 - 3542 |
|
~%
tris-(3,5-Dimet... CAS#:69227-47-0 |
| Literature: Tetrahedron Letters, , vol. 44, # 23 p. 4379 - 4383 |
|
~%
tris-(3,5-Dimet... CAS#:69227-47-0 |
| Literature: Tetrahedron Asymmetry, , vol. 15, # 11 p. 1673 - 1676 |
| MFCD03094579 |
| tris(3,5-dimethylphenyl)phosphane |