2-(benzylthio)-3-nitropyridine structure
|
Common Name | 2-(benzylthio)-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 69212-31-3 | Molecular Weight | 246.28500 | |
| Density | 1.32g/cm3 | Boiling Point | 394.6ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O2S | Melting Point | 70-72ºC(lit.) | |
| MSDS | USA | Flash Point | 192.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(benzylthio)-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 394.6ºC at 760 mmHg |
| Melting Point | 70-72ºC(lit.) |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.28500 |
| Flash Point | 192.4ºC |
| Exact Mass | 246.04600 |
| PSA | 84.01000 |
| LogP | 3.80530 |
| Index of Refraction | 1.653 |
| InChIKey | CRGAGHBQCBIQPJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccnc1SCc1ccccc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~10%
2-(benzylthio)-... CAS#:69212-31-3 |
| Literature: Ueki; Honda; Kazama; Katoh Synthesis, 1994 , # 1 p. 21 - 22 |
|
~%
2-(benzylthio)-... CAS#:69212-31-3 |
| Literature: Chemistry - An Asian Journal, , vol. 7, # 1 p. 45 - 49 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Benzylsulfanyl-3-nitropyridine |
| MFCD00209547 |
| benzyl 3-nitro-2-pyridyl sulfide |
| 3-NITRO-2-BENZYLSULFANYLPYRIDINE |
| 2-benzylthio-3-nitropyridine |